C24H24N2OS2 — CID 7634019
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 7634019) has the molecular formula C24H24N2OS2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 7634019 |
| Molecular Formula | C24H24N2OS2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-[1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | Cc1cc(C)cc(-n2c(C)cc(C(=O)CSC3=Nc4ccccc4CS3)c2C)c1 |
| InChI | InChI=1S/C24H24N2OS2/c1-15-9-16(2)11-20(10-15)26-17(3)12-21(18(26)4)23(27)14-29-24-25-22-8-6-5-7-19(22)13-28-24/h5-12H,13-14H2,1-4H3 |
| InChIKey | PKAIIPLEKYDCLZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|