C23H22N2OS2 — CID 7634002
(2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propan-1-one (PubChem CID 7634002) has the molecular formula C23H22N2OS2 and a molecular weight of 406.58 g/mol. Its IUPAC name is (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propan-1-one.
| Compound Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 7634002 |
| Molecular Formula | C23H22N2OS2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (2R)-2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)propan-1-one |
| SMILES | Cc1cc(C(=O)[C@@H](C)SC2=Nc3ccccc3CS2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C23H22N2OS2/c1-15-13-20(16(2)25(15)19-10-5-4-6-11-19)22(26)17(3)28-23-24-21-12-8-7-9-18(21)14-27-23/h4-13,17H,14H2,1-3H3/t17-/m1/s1 |
| InChIKey | CDMIGXJGTGSYFJ-QGZVFWFLSA-N |
| XLogP | 6.33 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|