C22H21N5OS — CID 7865453
(2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one (PubChem CID 7865453) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is (2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one.
| Compound Name | (2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 7865453 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2S)-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one |
| SMILES | Cc1cc(C(=O)[C@H](C)Sc2nnnn2-c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H21N5OS/c1-15-14-20(16(2)26(15)18-10-6-4-7-11-18)21(28)17(3)29-22-23-24-25-27(22)19-12-8-5-9-13-19/h4-14,17H,1-3H3/t17-/m0/s1 |
| InChIKey | YICCMIRUXOWUBL-KRWDZBQOSA-N |
| XLogP | 4.43 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|