C17H16N4O2S — CID 3777004
1-(4-hydroxy-3-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one (PubChem CID 3777004) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one.
| Compound Name | 1-(4-hydroxy-3-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 3777004 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-(4-hydroxy-3-methylphenyl)-2-(1-phenyltetrazol-5-yl)sulfanylpropan-1-one |
| SMILES | Cc1cc(C(=O)C(C)Sc2nnnn2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C17H16N4O2S/c1-11-10-13(8-9-15(11)22)16(23)12(2)24-17-18-19-20-21(17)14-6-4-3-5-7-14/h3-10,12,22H,1-2H3 |
| InChIKey | INDZBBQNBPHSDB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |