C17H17ClN4OS — CID 40550348
(2S)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-one (PubChem CID 40550348) has the molecular formula C17H17ClN4OS and a molecular weight of 360.87 g/mol. Its IUPAC name is (2S)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-one.
| Compound Name | (2S)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-one |
|---|---|
| PubChem CID | 40550348 |
| Molecular Formula | C17H17ClN4OS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2S)-1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-one |
| SMILES | Cc1cc(C(=O)[C@H](C)Sc2ncn[nH]2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4OS/c1-10-8-15(16(23)12(3)24-17-19-9-20-21-17)11(2)22(10)14-6-4-13(18)5-7-14/h4-9,12H,1-3H3,(H,19,20,21)/t12-/m0/s1 |
| InChIKey | GFAJLZWYSUDHGJ-LBPRGKRZSA-N |
| XLogP | 4.23 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|