C16H15BrN4OS — CID 40550336
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanone (PubChem CID 40550336) has the molecular formula C16H15BrN4OS and a molecular weight of 391.29 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 40550336 |
| Molecular Formula | C16H15BrN4OS |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-(1H-1,2,4-triazol-5-ylsulfanyl)ethanone |
| SMILES | Cc1cc(C(=O)CSc2ncn[nH]2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrN4OS/c1-10-7-14(15(22)8-23-16-18-9-19-20-16)11(2)21(10)13-5-3-12(17)4-6-13/h3-7,9H,8H2,1-2H3,(H,18,19,20) |
| InChIKey | ODNXONIKKINBEG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|