C19H19BrN4OS — CID 42124705
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 42124705) has the molecular formula C19H19BrN4OS and a molecular weight of 431.36 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 42124705 |
| Molecular Formula | C19H19BrN4OS |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | Cc1cc(C(=O)CSc2nncn2C2CC2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN4OS/c1-12-9-17(13(2)24(12)16-5-3-14(20)4-6-16)18(25)10-26-19-22-21-11-23(19)15-7-8-15/h3-6,9,11,15H,7-8,10H2,1-2H3 |
| InChIKey | UUEUSEYRYQAZKU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|