C23H25N3O2 — CID 110655035
N-[4-[[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]amino]phenyl]acetamide (PubChem CID 110655035) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[4-[[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 110655035 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[4-[[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NCC(=O)c2cc(C)n(-c3ccc(C)cc3)c2C)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-15-5-11-21(12-6-15)26-16(2)13-22(17(26)3)23(28)14-24-19-7-9-20(10-8-19)25-18(4)27/h5-13,24H,14H2,1-4H3,(H,25,27) |
| InChIKey | XGTUJNJFJKMCPZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|