C15H10BrF3N2O — CID 153386872
4-[3-(2-bromoacetyl)-2-methyl-5-(trifluoromethyl)pyrrol-1-yl]benzonitrile (PubChem CID 153386872) has the molecular formula C15H10BrF3N2O and a molecular weight of 371.16 g/mol. Its IUPAC name is 4-[3-(2-bromoacetyl)-2-methyl-5-(trifluoromethyl)pyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(2-bromoacetyl)-2-methyl-5-(trifluoromethyl)pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 153386872 |
| Molecular Formula | C15H10BrF3N2O |
| Molecular Weight | 371.16 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 4-[3-(2-bromoacetyl)-2-methyl-5-(trifluoromethyl)pyrrol-1-yl]benzonitrile |
| SMILES | Cc1c(C(=O)CBr)cc(C(F)(F)F)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H10BrF3N2O/c1-9-12(13(22)7-16)6-14(15(17,18)19)21(9)11-4-2-10(8-20)3-5-11/h2-6H,7H2,1H3 |
| InChIKey | ARQFFZSJUGYXBL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|