C22H30N2OS — CID 153386587
ethane;4-[2-methyl-5-(4-methylsulfanylbutyl)-3-propanoylpyrrol-1-yl]benzonitrile (PubChem CID 153386587) has the molecular formula C22H30N2OS and a molecular weight of 370.56 g/mol. Its IUPAC name is ethane;4-[2-methyl-5-(4-methylsulfanylbutyl)-3-propanoylpyrrol-1-yl]benzonitrile.
| Compound Name | ethane;4-[2-methyl-5-(4-methylsulfanylbutyl)-3-propanoylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 153386587 |
| Molecular Formula | C22H30N2OS |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | ethane;4-[2-methyl-5-(4-methylsulfanylbutyl)-3-propanoylpyrrol-1-yl]benzonitrile |
| SMILES | CC.CCC(=O)c1cc(CCCCSC)n(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C20H24N2OS.C2H6/c1-4-20(23)19-13-18(7-5-6-12-24-3)22(15(19)2)17-10-8-16(14-21)9-11-17;1-2/h8-11,13H,4-7,12H2,1-3H3;1-2H3 |
| InChIKey | QEGOYQPYWBFZOH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|