C26H35N3OS — CID 153386752
4-[3-[2-(2-ethyl-5-methylpyrrolidin-1-yl)acetyl]-2-methyl-5-(4-methylsulfanylbutyl)pyrrol-1-yl]benzonitrile (PubChem CID 153386752) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is 4-[3-[2-(2-ethyl-5-methylpyrrolidin-1-yl)acetyl]-2-methyl-5-(4-methylsulfanylbutyl)pyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-[2-(2-ethyl-5-methylpyrrolidin-1-yl)acetyl]-2-methyl-5-(4-methylsulfanylbutyl)pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 153386752 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 4-[3-[2-(2-ethyl-5-methylpyrrolidin-1-yl)acetyl]-2-methyl-5-(4-methylsulfanylbutyl)pyrrol-1-yl]benzonitrile |
| SMILES | CCC1CCC(C)N1CC(=O)c1cc(CCCCSC)n(-c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C26H35N3OS/c1-5-22-12-9-19(2)28(22)18-26(30)25-16-24(8-6-7-15-31-4)29(20(25)3)23-13-10-21(17-27)11-14-23/h10-11,13-14,16,19,22H,5-9,12,15,18H2,1-4H3 |
| InChIKey | NFDCINQMROORDS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|