C22H21F2N3O4 — CID 26821238
N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 26821238) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 26821238 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N'-[4-(difluoromethoxy)-3-methoxybenzoyl]-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(C)n(-c3ccccc3)c2C)ccc1OC(F)F |
| InChI | InChI=1S/C22H21F2N3O4/c1-13-11-17(14(2)27(13)16-7-5-4-6-8-16)21(29)26-25-20(28)15-9-10-18(31-22(23)24)19(12-15)30-3/h4-12,22H,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | HFSFRNUSQRGEEZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|