C21H23N3O2 — CID 3481962
N'-(bicyclo[2.2.1]hept-5-ene-2-carbonyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 3481962) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N'-(bicyclo[2.2.1]hept-5-ene-2-carbonyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-(bicyclo[2.2.1]hept-5-ene-2-carbonyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 3481962 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N'-(bicyclo[2.2.1]hept-5-ene-2-carbonyl)-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)C2CC3C=CC2C3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H23N3O2/c1-13-10-18(14(2)24(13)17-6-4-3-5-7-17)20(25)22-23-21(26)19-12-15-8-9-16(19)11-15/h3-10,15-16,19H,11-12H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | MAUUEIYFIFXFPJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|