C20H20Cl2N4O2S — CID 31714742
5-chloro-1-[(2-chlorophenyl)methyl]-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-3-methylpyrazole-4-carbohydrazide (PubChem CID 31714742) has the molecular formula C20H20Cl2N4O2S and a molecular weight of 451.38 g/mol. Its IUPAC name is 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-3-methylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-3-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 31714742 |
| Molecular Formula | C20H20Cl2N4O2S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N'-(5-ethyl-4-methylthiophene-2-carbonyl)-3-methylpyrazole-4-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNC(=O)c2c(C)nn(Cc3ccccc3Cl)c2Cl)cc1C |
| InChI | InChI=1S/C20H20Cl2N4O2S/c1-4-15-11(2)9-16(29-15)19(27)23-24-20(28)17-12(3)25-26(18(17)22)10-13-7-5-6-8-14(13)21/h5-9H,4,10H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | AMQDZGKRLZABEN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|