C21H17Cl2N5O2 — CID 29355154
N'-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carbonyl]-1H-indole-3-carbohydrazide (PubChem CID 29355154) has the molecular formula C21H17Cl2N5O2 and a molecular weight of 442.31 g/mol. Its IUPAC name is N'-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carbonyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carbonyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 29355154 |
| Molecular Formula | C21H17Cl2N5O2 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N'-[5-chloro-1-[(2-chlorophenyl)methyl]-3-methylpyrazole-4-carbonyl]-1H-indole-3-carbohydrazide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)NNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H17Cl2N5O2/c1-12-18(19(23)28(27-12)11-13-6-2-4-8-16(13)22)21(30)26-25-20(29)15-10-24-17-9-5-3-7-14(15)17/h2-10,24H,11H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | JIWUGUZPHQURHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|