C21H21Cl2N3O2 — CID 86973065
5-chloro-1-[(2-chlorophenyl)methyl]-N-[3-(4-hydroxyphenyl)propyl]-3-methylpyrazole-4-carboxamide (PubChem CID 86973065) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 5-chloro-1-[(2-chlorophenyl)methyl]-N-[3-(4-hydroxyphenyl)propyl]-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N-[3-(4-hydroxyphenyl)propyl]-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86973065 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 5-chloro-1-[(2-chlorophenyl)methyl]-N-[3-(4-hydroxyphenyl)propyl]-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(Cl)c1C(=O)NCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-14-19(20(23)26(25-14)13-16-6-2-3-7-18(16)22)21(28)24-12-4-5-15-8-10-17(27)11-9-15/h2-3,6-11,27H,4-5,12-13H2,1H3,(H,24,28) |
| InChIKey | BFEFXECAOXYQBQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|