C25H27N5O2 — CID 55484568
(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 55484568) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55484568 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]-N-[4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C/C(=O)Nc3ccc(N4CCNC4=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H27N5O2/c1-17-4-6-20(7-5-17)16-30-19(3)23(18(2)28-30)12-13-24(31)27-21-8-10-22(11-9-21)29-15-14-26-25(29)32/h4-13H,14-16H2,1-3H3,(H,26,32)(H,27,31)/b13-12+ |
| InChIKey | XUMDFJNNOZEXSU-OUKQBFOZSA-N |
| XLogP | 4.04 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|