C19H24N4O2 — CID 134045724
2-[[(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]propanamide (PubChem CID 134045724) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[[(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]propanamide.
| Compound Name | 2-[[(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 134045724 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[[(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoyl]amino]propanamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=C/C(=O)NC(C)C(N)=O)c2C)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-12-5-7-16(8-6-12)11-23-15(4)17(13(2)22-23)9-10-18(24)21-14(3)19(20)25/h5-10,14H,11H2,1-4H3,(H2,20,25)(H,21,24)/b10-9+ |
| InChIKey | LMEBRADVCPSIRP-MDZDMXLPSA-N |
| XLogP | 1.86 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|