C17H16N4O2 — CID 134048303
(E)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 134048303) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (E)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 134048303 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (E)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1ccc(N2CCNC2=O)cc1 |
| InChI | InChI=1S/C17H16N4O2/c22-16(8-3-13-2-1-9-18-12-13)20-14-4-6-15(7-5-14)21-11-10-19-17(21)23/h1-9,12H,10-11H2,(H,19,23)(H,20,22)/b8-3+ |
| InChIKey | HEBPJTBTUPDRMG-FPYGCLRLSA-N |
| XLogP | 2.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|