C19H15ClN4O — CID 31404536
5-chloro-1,3-dimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide (PubChem CID 31404536) has the molecular formula C19H15ClN4O and a molecular weight of 350.81 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-1,3-dimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31404536 |
| Molecular Formula | C19H15ClN4O |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 5-chloro-1,3-dimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(Cl)c1C(=O)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C19H15ClN4O/c1-13-17(18(20)24(2)23-13)19(25)22-16-8-5-6-14(12-16)9-10-15-7-3-4-11-21-15/h3-8,11-12H,1-2H3,(H,22,25) |
| InChIKey | BJNLFKBTZMINFY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|