C12H11ClIN3O — CID 18279909
5-chloro-N-(4-iodophenyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 18279909) has the molecular formula C12H11ClIN3O and a molecular weight of 375.60 g/mol. Its IUPAC name is 5-chloro-N-(4-iodophenyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-(4-iodophenyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18279909 |
| Molecular Formula | C12H11ClIN3O |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 5-chloro-N-(4-iodophenyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(Cl)c1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H11ClIN3O/c1-7-10(11(13)17(2)16-7)12(18)15-9-5-3-8(14)4-6-9/h3-6H,1-2H3,(H,15,18) |
| InChIKey | VWTNFIAWYQXNOH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|