C7H10ClN3O2 — CID 47143740
5-chloro-N-methoxy-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 47143740) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 5-chloro-N-methoxy-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-methoxy-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 47143740 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 5-chloro-N-methoxy-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | CONC(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C7H10ClN3O2/c1-4-5(7(12)10-13-3)6(8)11(2)9-4/h1-3H3,(H,10,12) |
| InChIKey | FQQDMCHWUQOVAG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|