C16H20ClN3O3 — CID 24610680
5-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 24610680) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24610680 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 5-chloro-N-[2-(4-ethoxyphenoxy)ethyl]-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(OCCNC(=O)c2c(C)nn(C)c2Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-4-22-12-5-7-13(8-6-12)23-10-9-18-16(21)14-11(2)19-20(3)15(14)17/h5-8H,4,9-10H2,1-3H3,(H,18,21) |
| InChIKey | ZJSAXZRVFHISJU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|