C24H20N2O3 — CID 55550342
(E)-3-(3,4-dimethoxyphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide (PubChem CID 55550342) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55550342 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cccc(C#Cc3ccccn3)c2)cc1OC |
| InChI | InChI=1S/C24H20N2O3/c1-28-22-13-10-19(17-23(22)29-2)11-14-24(27)26-21-8-5-6-18(16-21)9-12-20-7-3-4-15-25-20/h3-8,10-11,13-17H,1-2H3,(H,26,27)/b14-11+ |
| InChIKey | UPKXNUMMXGRQOR-SDNWHVSQSA-N |
| XLogP | 4.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|