C19H17NO3 — CID 30779152
(E)-3-(3,4-dimethoxyphenyl)-N-(3-ethynylphenyl)prop-2-enamide (PubChem CID 30779152) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethynylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethynylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30779152 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(3-ethynylphenyl)prop-2-enamide |
| SMILES | C#Cc1cccc(NC(=O)/C=C/c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H17NO3/c1-4-14-6-5-7-16(12-14)20-19(21)11-9-15-8-10-17(22-2)18(13-15)23-3/h1,5-13H,2-3H3,(H,20,21)/b11-9+ |
| InChIKey | NWKASIAJRUJREB-PKNBQFBNSA-N |
| XLogP | 3.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|