C21H19NO7 — CID 157466142
4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 157466142) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 157466142 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cccc(C(O)=CC(=O)C(=O)O)c2)cc1OC |
| InChI | InChI=1S/C21H19NO7/c1-28-18-8-6-13(10-19(18)29-2)7-9-20(25)22-15-5-3-4-14(11-15)16(23)12-17(24)21(26)27/h3-12,23H,1-2H3,(H,22,25)(H,26,27)/b9-7+,16-12? |
| InChIKey | LQKPAISWRROEGZ-YPJIHQTBSA-N |
| XLogP | 2.91 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|