C20H17NO6 — CID 71717789
(E)-4-hydroxy-4-[3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]-2-oxobut-3-enoic acid (PubChem CID 71717789) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is (E)-4-hydroxy-4-[3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]-2-oxobut-3-enoic acid.
| Compound Name | (E)-4-hydroxy-4-[3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 71717789 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (E)-4-hydroxy-4-[3-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]phenyl]-2-oxobut-3-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cccc(/C(O)=C\C(=O)C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H17NO6/c1-27-16-8-5-13(6-9-16)7-10-19(24)21-15-4-2-3-14(11-15)17(22)12-18(23)20(25)26/h2-12,22H,1H3,(H,21,24)(H,25,26)/b10-7+,17-12+ |
| InChIKey | ODAPGHPTSBVWDK-KQOXKNJESA-N |
| XLogP | 2.90 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|