C27H27NO6 — CID 46794103
[2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 46794103) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46794103 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OC(C(=O)Nc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H27NO6/c1-18-10-13-21(14-11-18)28-27(30)26(19-8-6-5-7-9-19)34-25(29)15-12-20-16-23(32-3)24(33-4)17-22(20)31-2/h5-17,26H,1-4H3,(H,28,30)/b15-12+ |
| InChIKey | BNXNINFNNSHWLI-NTCAYCPXSA-N |
| XLogP | 4.96 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|