C24H27NO6 — CID 8641093
[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 8641093) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8641093 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)O[C@H](C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO6/c1-28-19-16-21(30-3)20(29-2)15-18(19)11-12-22(26)31-23(17-9-5-4-6-10-17)24(27)25-13-7-8-14-25/h4-6,9-12,15-16,23H,7-8,13-14H2,1-3H3/b12-11+/t23-/m0/s1 |
| InChIKey | KFLWNINNMGNQGD-RGPPVUSESA-N |
| XLogP | 3.63 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|