C23H25NO5 — CID 7697931
[(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 7697931) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7697931 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(1S)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)O[C@H](C(=O)N2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO5/c1-27-19-11-12-20(28-2)18(16-19)10-13-21(25)29-22(17-8-4-3-5-9-17)23(26)24-14-6-7-15-24/h3-5,8-13,16,22H,6-7,14-15H2,1-2H3/b13-10+/t22-/m0/s1 |
| InChIKey | ZRPULOMNUHCEOG-FLSMSTFGSA-N |
| XLogP | 3.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|