C22H25N3O5 — CID 24579228
(2-oxo-1-phenyl-2-piperidin-1-ylethyl) (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate (PubChem CID 24579228) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-piperidin-1-ylethyl) (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate.
| Compound Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 24579228 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (2-oxo-1-phenyl-2-piperidin-1-ylethyl) (E)-3-(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)prop-2-enoate |
| SMILES | Cn1cc(/C=C/C(=O)OC(C(=O)N2CCCCC2)c2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C22H25N3O5/c1-23-15-17(20(27)24(2)22(23)29)11-12-18(26)30-19(16-9-5-3-6-10-16)21(28)25-13-7-4-8-14-25/h3,5-6,9-12,15,19H,4,7-8,13-14H2,1-2H3/b12-11+ |
| InChIKey | QXBLGNXCKRBLBI-VAWYXSNFSA-N |
| XLogP | 1.39 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|