C22H17ClINO4 — CID 6282314
[2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 6282314) has the molecular formula C22H17ClINO4 and a molecular weight of 521.74 g/mol. Its IUPAC name is [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6282314 |
| Molecular Formula | C22H17ClINO4 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | [2-(3-chloro-4-methylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)/C=C/c2ccc(I)o2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H17ClINO4/c1-14-7-8-16(13-18(14)23)25-22(27)21(15-5-3-2-4-6-15)29-20(26)12-10-17-9-11-19(24)28-17/h2-13,21H,1H3,(H,25,27)/b12-10+ |
| InChIKey | QAPSSGZPNVAMSB-ZRDIBKRKSA-N |
| XLogP | 5.78 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|