C24H23NO4 — CID 2424908
[(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 2424908) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2424908 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [(1R)-2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](OC(=O)/C=C/c2ccc(C)o2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO4/c1-16-9-10-17(2)21(15-16)25-24(27)23(19-7-5-4-6-8-19)29-22(26)14-13-20-12-11-18(3)28-20/h4-15,23H,1-3H3,(H,25,27)/b14-13+/t23-/m1/s1 |
| InChIKey | TVVPOOXAVKSDEA-YAOQVBECSA-N |
| XLogP | 5.14 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|