C22H15BrF3NO4 — CID 5022068
[2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 5022068) has the molecular formula C22H15BrF3NO4 and a molecular weight of 494.26 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 5022068 |
| Molecular Formula | C22H15BrF3NO4 |
| Molecular Weight | 494.26 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | [2-oxo-1-phenyl-2-[3-(trifluoromethyl)anilino]ethyl] 3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(Br)o1)OC(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H15BrF3NO4/c23-18-11-9-17(30-18)10-12-19(28)31-20(14-5-2-1-3-6-14)21(29)27-16-8-4-7-15(13-16)22(24,25)26/h1-13,20H,(H,27,29) |
| InChIKey | GTDIXHMDNKHZOX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.26 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|