C25H27ClN4O2 — CID 26953980
(E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 26953980) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 26953980 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (E)-N-[2-(tert-butylamino)-2-oxoethyl]-3-[1-[(2-chlorophenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)/C=C/c1cn(Cc2ccccc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H27ClN4O2/c1-25(2,3)28-23(32)15-27-22(31)14-13-20-17-30(16-19-11-7-8-12-21(19)26)29-24(20)18-9-5-4-6-10-18/h4-14,17H,15-16H2,1-3H3,(H,27,31)(H,28,32)/b14-13+ |
| InChIKey | DXBBMKRQLLWCJY-BUHFOSPRSA-N |
| XLogP | 4.30 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|