C19H14Cl3N3O — CID 19287743
(E)-N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 19287743) has the molecular formula C19H14Cl3N3O and a molecular weight of 406.70 g/mol. Its IUPAC name is (E)-N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19287743 |
| Molecular Formula | C19H14Cl3N3O |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (E)-N-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1nn(Cc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl3N3O/c20-15-7-3-1-5-13(15)9-10-18(26)23-19-17(22)12-25(24-19)11-14-6-2-4-8-16(14)21/h1-10,12H,11H2,(H,23,24,26)/b10-9+ |
| InChIKey | KNWPJYDLCXPCCK-MDZDMXLPSA-N |
| XLogP | 5.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|