C20H16ClN3O — CID 117055104
(E)-3-(2-chlorophenyl)-N-[(2-pyridin-3-yl-3-pyridinyl)methyl]prop-2-enamide (PubChem CID 117055104) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[(2-pyridin-3-yl-3-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[(2-pyridin-3-yl-3-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 117055104 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[(2-pyridin-3-yl-3-pyridinyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NCc1cccnc1-c1cccnc1 |
| InChI | InChI=1S/C20H16ClN3O/c21-18-8-2-1-5-15(18)9-10-19(25)24-14-17-7-4-12-23-20(17)16-6-3-11-22-13-16/h1-13H,14H2,(H,24,25)/b10-9+ |
| InChIKey | SSQGYPQDFHAQNW-MDZDMXLPSA-N |
| XLogP | 4.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|