C29H30N4O3 — CID 55529382
3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 55529382) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55529382 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(CCN(C)C(=O)C=Cc2cn(Cc3ccccc3)nc2-c2cccnc2)cc1OC |
| InChI | InChI=1S/C29H30N4O3/c1-32(17-15-22-11-13-26(35-2)27(18-22)36-3)28(34)14-12-25-21-33(20-23-8-5-4-6-9-23)31-29(25)24-10-7-16-30-19-24/h4-14,16,18-19,21H,15,17,20H2,1-3H3 |
| InChIKey | YPONBHSIIKGTJN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|