C20H22BrNO3 — CID 9468467
(E)-3-(2-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 9468467) has the molecular formula C20H22BrNO3 and a molecular weight of 404.30 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9468467 |
| Molecular Formula | C20H22BrNO3 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(CCN(C)C(=O)/C=C/c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C20H22BrNO3/c1-22(20(23)11-9-16-6-4-5-7-17(16)21)13-12-15-8-10-18(24-2)19(14-15)25-3/h4-11,14H,12-13H2,1-3H3/b11-9+ |
| InChIKey | HMNHYKRMZNQRBL-PKNBQFBNSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|