C25H28N2O4S — CID 26031654
(E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 26031654) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26031654 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1ccc(CCN(C)C(=O)/C=C/c2ccc(OCc3csc(C)n3)cc2)cc1OC |
| InChI | InChI=1S/C25H28N2O4S/c1-18-26-21(17-32-18)16-31-22-9-5-19(6-10-22)8-12-25(28)27(2)14-13-20-7-11-23(29-3)24(15-20)30-4/h5-12,15,17H,13-14,16H2,1-4H3/b12-8+ |
| InChIKey | MUEMUBNVZMZOKM-XYOKQWHBSA-N |
| XLogP | 4.76 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|