C22H28N2O3S — CID 91943186
N-[4-(hydroxymethyl)cyclohexyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 91943186) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)cyclohexyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | N-[4-(hydroxymethyl)cyclohexyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91943186 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[4-(hydroxymethyl)cyclohexyl]-N-methyl-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(C=CC(=O)N(C)C3CCC(CO)CC3)cc2)cs1 |
| InChI | InChI=1S/C22H28N2O3S/c1-16-23-19(15-28-16)14-27-21-10-5-17(6-11-21)7-12-22(26)24(2)20-8-3-18(13-25)4-9-20/h5-7,10-12,15,18,20,25H,3-4,8-9,13-14H2,1-2H3 |
| InChIKey | QBZRUCUFECWOPM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|