C16H16FN3O3S — CID 108908056
1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(4-sulfamoylphenyl)methyl]urea (PubChem CID 108908056) has the molecular formula C16H16FN3O3S and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(4-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(4-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 108908056 |
| Molecular Formula | C16H16FN3O3S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[(E)-2-(4-fluorophenyl)ethenyl]-3-[(4-sulfamoylphenyl)methyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)N/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FN3O3S/c17-14-5-1-12(2-6-14)9-10-19-16(21)20-11-13-3-7-15(8-4-13)24(18,22)23/h1-10H,11H2,(H2,18,22,23)(H2,19,20,21)/b10-9+ |
| InChIKey | YXZSXETXPVRPHP-MDZDMXLPSA-N |
| XLogP | 1.94 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |