C24H22N4O3 — CID 126807088
4-[3-(4-acetamidophenyl)prop-2-enoylamino]-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 126807088) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-[3-(4-acetamidophenyl)prop-2-enoylamino]-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 4-[3-(4-acetamidophenyl)prop-2-enoylamino]-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 126807088 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[3-(4-acetamidophenyl)prop-2-enoylamino]-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | CC(=O)Nc1ccc(C=CC(=O)Nc2ccc(C(=O)NCc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-17(29)27-21-7-2-18(3-8-21)4-11-23(30)28-22-9-5-20(6-10-22)24(31)26-16-19-12-14-25-15-13-19/h2-15H,16H2,1H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | MQKYVXMBHSBLII-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|