C19H20FN3O2 — CID 38175849
(E)-3-(4-fluorophenyl)-N-[4-(propan-2-ylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 38175849) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[4-(propan-2-ylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[4-(propan-2-ylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 38175849 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[4-(propan-2-ylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | CC(C)NC(=O)Nc1ccc(NC(=O)/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13(2)21-19(25)23-17-10-8-16(9-11-17)22-18(24)12-5-14-3-6-15(20)7-4-14/h3-13H,1-2H3,(H,22,24)(H2,21,23,25)/b12-5+ |
| InChIKey | DRYOZLUXHVDOLC-LFYBBSHMSA-N |
| XLogP | 4.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|