C13H11BrN2O3S — CID 43548159
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-5-bromothiophene-2-carboxamide (PubChem CID 43548159) has the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-5-bromothiophene-2-carboxamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-5-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43548159 |
| Molecular Formula | C13H11BrN2O3S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-5-bromothiophene-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1ccc(Br)s1)OCCO2 |
| InChI | InChI=1S/C13H11BrN2O3S/c14-12-2-1-11(20-12)13(17)16-8-6-10-9(5-7(8)15)18-3-4-19-10/h1-2,5-6H,3-4,15H2,(H,16,17) |
| InChIKey | OUIIWQYLOYWZNM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|