C13H10Br2N2O3S — CID 80534473
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-4,5-dibromothiophene-2-carboxamide (PubChem CID 80534473) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 80534473 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-4,5-dibromothiophene-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1cc(Br)c(Br)s1)OCCO2 |
| InChI | InChI=1S/C13H10Br2N2O3S/c14-6-3-11(21-12(6)15)13(18)17-8-5-10-9(4-7(8)16)19-1-2-20-10/h3-5H,1-2,16H2,(H,17,18) |
| InChIKey | PUIAAYCBVFTZDB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|