C15H14BrClN2O3S — CID 55512069
5-bromo-N'-[3-(3-chloro-4-methoxyphenyl)propanoyl]thiophene-2-carbohydrazide (PubChem CID 55512069) has the molecular formula C15H14BrClN2O3S and a molecular weight of 417.71 g/mol. Its IUPAC name is 5-bromo-N'-[3-(3-chloro-4-methoxyphenyl)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[3-(3-chloro-4-methoxyphenyl)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55512069 |
| Molecular Formula | C15H14BrClN2O3S |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 5-bromo-N'-[3-(3-chloro-4-methoxyphenyl)propanoyl]thiophene-2-carbohydrazide |
| SMILES | COc1ccc(CCC(=O)NNC(=O)c2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C15H14BrClN2O3S/c1-22-11-4-2-9(8-10(11)17)3-7-14(20)18-19-15(21)12-5-6-13(16)23-12/h2,4-6,8H,3,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | CXPMGNVQIPXZCH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|