C16H17BrClNO2S — CID 55512669
N-[(5-bromothiophen-2-yl)methyl]-3-(3-chloro-4-methoxyphenyl)-N-methylpropanamide (PubChem CID 55512669) has the molecular formula C16H17BrClNO2S and a molecular weight of 402.74 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-(3-chloro-4-methoxyphenyl)-N-methylpropanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-(3-chloro-4-methoxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 55512669 |
| Molecular Formula | C16H17BrClNO2S |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-(3-chloro-4-methoxyphenyl)-N-methylpropanamide |
| SMILES | COc1ccc(CCC(=O)N(C)Cc2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C16H17BrClNO2S/c1-19(10-12-5-7-15(17)22-12)16(20)8-4-11-3-6-14(21-2)13(18)9-11/h3,5-7,9H,4,8,10H2,1-2H3 |
| InChIKey | ISPRMBMVSBIMFG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |