C15H20ClNO4 — CID 61031323
methyl 3-[3-(3-chloro-4-methoxyphenyl)propanoyl-methylamino]propanoate (PubChem CID 61031323) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is methyl 3-[3-(3-chloro-4-methoxyphenyl)propanoyl-methylamino]propanoate.
| Compound Name | methyl 3-[3-(3-chloro-4-methoxyphenyl)propanoyl-methylamino]propanoate |
|---|---|
| PubChem CID | 61031323 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 3-[3-(3-chloro-4-methoxyphenyl)propanoyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)C(=O)CCc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO4/c1-17(9-8-15(19)21-3)14(18)7-5-11-4-6-13(20-2)12(16)10-11/h4,6,10H,5,7-9H2,1-3H3 |
| InChIKey | GFNOVCVVKPEXRX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |