C13H13BrClNO3S2 — CID 37498744
N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 37498744) has the molecular formula C13H13BrClNO3S2 and a molecular weight of 410.74 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 37498744 |
| Molecular Formula | C13H13BrClNO3S2 |
| Molecular Weight | 410.74 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-chloro-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)Cc2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C13H13BrClNO3S2/c1-16(8-9-3-6-13(14)20-9)21(17,18)10-4-5-12(19-2)11(15)7-10/h3-7H,8H2,1-2H3 |
| InChIKey | QCKOBKLYKBQZRJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.74 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |